تفاعل #155334

ord-51517834f70f4e848ca03048712def70

معادلة التفاعل

NN.O
Hydrazine hydrate
CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCCN3C(=O)c4ccccc4C3=O)c12
2-{3-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxy-4H-quinolin-1-yl]propyl}isoindole-1,3-dione
CCCOc1ccc(F)c2c(=O)c(-c3ccc(OC)cc3)cn(CCCN)c12
1-(3-aminopropyl)-5-fluoro-3-(4-methoxyphenyl)-8-propoxy-1H-quinolin-4-one
المردود 94.0%

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةheated
  2. 2
    درجة الحرارةunder reflux for 4 hours
  3. 3
    تركيزThe resulting mixture was concentrated under reduced pressure
  4. 4
    workup.ADDITIONa 5N aqueous sodium hydroxide solution was added to the thus-obtained residue
  5. 5
    استخلاصthe resulting mixture was subjected to extraction
  6. 6
    غسيلThe thus-obtained organic layer was sequentially washed with water
  7. 7
    تجفيفan aqueous saturated sodium chloride solution, dried over anhydrous magnesium sulfate
  8. 8
    تركيزconcentrated under reduced pressure

الإجراء التجريبي

Hydrazine hydrate (0.62 ml, 12.8 mmol) was added to an ethanol solution (60 ml) of 2-{3-[5-fluoro-3-(4-methoxyphenyl)-4-oxo-8-propoxy-4H-quinolin-1-yl]propyl}isoindole-1,3-dione (2.0 g, 3.88 mmol) and heated under reflux for 4 hours. The resulting mixture was concentrated under reduced pressure, a 5N aqueous sodium hydroxide solution was added to the thus-obtained residue, and then the resulting mixture was subjected to extraction using dichloromethane. The thus-obtained organic layer was sequentially washed with water and an aqueous saturated sodium chloride solution, dried over anhydrous magnesium sulfate, and then concentrated under reduced pressure, giving a yellow oily 1-(3-aminopropyl)-5-fluoro-3-(4-methoxyphenyl)-8-propoxy-1H-quinolin-4-one (1.4 g, yield: 94%).

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: USRE045108E1uspto-grants-2014_09