تفاعل #1552056

ord-f425b498168f4341b45de38d74c006ef

معادلة التفاعل

C=CCOc1ccc([N+](=O)[O-])c(CO)c1
5-allyloxy-2-nitrobenzyl alcohol
O=C(OO)c1cccc(Cl)c1
m-chloroperoxybenzoic acid
O=[N+]([O-])c1ccc(OCC2CO2)cc1CO
5-glycidyloxy-2-nitrobenzyl alcohol

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىpeaks disappeared from the 1H-NMR spectrum (approximately 48 hours)
  2. 2
    غسيلThe reaction was then washed with aqueous sodium carbonate twice
  3. 3
    تجفيفwater three times and then dried over sodium sulfate
  4. 4
    أخرىThe solvent was partially removed by rotary evaporation
  5. 5
    workup.ADDITIONpoured into hexanes
  6. 6
    أخرىto precipitate the product
  7. 7
    ترشيحThe resulting solid was collected by suction filtration
  8. 8
    أخرىwas used in the next step without further purification

الإجراء التجريبي

5-allyloxy-2-nitrobenzyl alcohol (7.3 g, 35 mmol) and m-chloroperoxybenzoic acid (77 wt. %, 9.4 g, 42 mmol) were dissolved in dichloromethane and refluxed until the allyl peaks disappeared from the 1H-NMR spectrum (approximately 48 hours). The reaction was then washed with aqueous sodium carbonate twice, water three times and then dried over sodium sulfate. The solvent was partially removed by rotary evaporation and then poured into hexanes to precipitate the product. The resulting solid was collected by suction filtration and was used in the next step without further purification.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08999623B2uspto-grants-2015_04