تفاعل #1510

ord-7d2c74c555f047899e0fbc54d1163d31

معادلة التفاعل

[K+].[OH-]
potassium hydroxide
O=C(O)C1CCc2cc(O)ccc2C1
1,2,3,4-tetrahydro-6-hydroxynaphthalene-2-carboxylic acid
BrCc1ccccc1
benzyl bromide
[K+].[OH-]
potassium hydroxide
Cl
hydrochloric acid
O=C(O)C1CCc2cc(OCc3ccccc3)ccc2C1
1,2,3,4-tetrahydro-6-benzyloxynaphthalene-2-carboxylic acid
المردود 92.8%

المذيبات

ظروف التفاعل

درجة الحرارة
100°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةwas heated
  2. 2
    درجة الحرارةby heating
  3. 3
    درجة الحرارةunder reflux at that temperature for 2 hours
  4. 4
    درجة الحرارةto cool up to room temperature
  5. 5
    ترشيحThe resulting deposited product was filtered
  6. 6
    أخرىrecrystallized from toluene

الإجراء التجريبي

A mixture of 10.60 g (50 mmol) of 1,2,3,4-tetrahydro-6-hydroxynaphthalene-2-carboxylic acid, 12.85 g (75 mmol) of benzyl bromide, 6.6 g (100 mmol) of 85% potassium hydroxide, 0.525 g (3.5 mmol) of sodium iodide, 200 ml of ethanol and 25 ml of distilled water was heated under reflux at 100° C. for 12 hours. To this reaction mixture was added 50 ml of 10% potassium hydroxide, followed by heating under reflux at that temperature for 2 hours. After allowing the reaction system to cool up to room temperature, the reaction mixture in cold water was acidified with 36% hydrochloric acid. The resulting deposited product was filtered, and recrystallized from toluene to obtain 13.08 g (46.4 mmol) of 1,2,3,4-tetrahydro-6-benzyloxynaphthalene-2-carboxylic acid.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05725798uspto-grants-1998_03