تفاعل #1509622

ord-c261ac37a2524664a3e01561aeec34f6

معادلة التفاعل

CC(C)CNC(=O)CCCc1cn(C(=O)OC(C)(C)C)c(N)n1
2-amino-4-(3-isobutylcarbamoyl-propyl)-imidazole-1-carboxylic acid tert-butyl ester
ClCCl
dichloromethane
O=C(O)C(F)(F)F
TFA
CC(C)CNC(=O)CCCc1c[nH]c(N)n1.Cl
compound 8
المردود 97.0%
CC(C)CNC(=O)CCCc1c[nH]c(N)n1.Cl
4-(2-amino-1H-imidazol-4-yl)-N-isobutyl-butyramide hydrochloride
المردود 97.0%

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىAfter that time the reaction was evaporated to dryness and toluene (2 mL)
  2. 2
    workup.ADDITIONwas added
  3. 3
    تركيزAgain the mixture was concentrated
  4. 4
    workup.DISSOLUTIONThe resulting TFA salt was dissolved in dichloromethane (1 mL)
  5. 5
    workup.ADDITION2M HCl in diethyl ether (0.50 mL) was added
  6. 6
    ترشيحwas collected by filtration
  7. 7
    غسيلwashed with diethyl ether (3 mL)

الإجراء التجريبي

A solution of 2-amino-4-(3-isobutylcarbamoyl-propyl)-imidazole-1-carboxylic acid tert-butyl ester 23 (76 mg, 0.234 mmol) in anhydrous dichloromethane (1 mL) was cooled to 0° C. TFA (1 mL) was charged into the flask and the reaction stirred for 5 h. After that time the reaction was evaporated to dryness and toluene (2 mL) was added. Again the mixture was concentrated and the process repeated. The resulting TFA salt was dissolved in dichloromethane (1 mL) and 2M HCl in diethyl ether (0.50 mL) was added followed by cold diethyl ether (8 mL) The precipitate was collected by filtration and washed with diethyl ether (3 mL) to yield the target compound 8 (59 mg, 97%) as a tan solid. 1H NMR (300 MHz, DMSO-d6) δ 12.14 (s, 1H), 11.70 (s, 1H), 7.89 (m, 1H), 7.34 (br s, 2H), 6.55 (s, 1H), 2.84 (t, 2H, J=6.6 Hz), 2.38 (t, 2H, J=7.5 Hz), 2.10 (t, 2H, J=7.5 Hz), 1.60-1.79 (m, 3H), 0.82 (d, 6H, J=6.3 Hz); 13C NMR (75 MHz, DMSO-d6) δ 171.52, 146.78, 126.31, 108.68, 46.00, 34.41, 28.09, 23.94, 23.64, 20.18; HRMS (ESI) calcd for C11H21N4O (MH)+ 225.1709, found 225.1711.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08927029B2uspto-grants-2015_01