تفاعل #1509620

ord-d83e557327954aa4be3fd8e13e818997

معادلة التفاعل

O=C(CBr)CCCC(=O)OCc1ccccc1
6-bromo-5-oxo-hexanoic acid benzyl ester
CC(C)(C)OC(=O)NC(=N)N
Boc-guanidine
CC(C)(C)OC(=O)n1cc(CCCC(=O)OCc2ccccc2)nc1N
title compound
المردود 66.0%
CC(C)(C)OC(=O)n1cc(CCCC(=O)OCc2ccccc2)nc1N
2-amino-4-(3-benzyloxycarbonyl-propyl)-imidazole-1-carboxylic acid tert-butyl ester
المردود 66.0%

الكواشف

لا شيء

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىAfter 48 h the DMF was removed under reduced pressure
  2. 2
    غسيلwashed with water (3×50 mL) and brine (50 mL)
  3. 3
    تجفيفbefore being dried (Na2SO4)
  4. 4
    ترشيحfiltered
  5. 5
    أخرىevaporated to dryness
  6. 6
    أخرىThe resulting oil was purified by flash column chromatography (30-100% EtOAc/Hexanes)

الإجراء التجريبي

6-bromo-5-oxo-hexanoic acid benzyl ester (3.42 g, 11.99 mmol) and Boc-guanidine (5.73 g, 35.97 mmol) were dissolved in DMF (35 mL) and allowed to stir at room temperature. After 48 h the DMF was removed under reduced pressure and the residue was taken up in ethyl acetate (100 mL) and washed with water (3×50 mL) and brine (50 mL) before being dried (Na2SO4), filtered and evaporated to dryness. The resulting oil was purified by flash column chromatography (30-100% EtOAc/Hexanes) to obtain the title compound (2.79 g, 66%) as a colorless oil which solidified upon prolonged standing. 1H NMR (400 MHz, CDCl3) δ 7.35 (m, 5H), 6.51 (s, 1H), 5.91 (s, 2H), 5.12 (s, 2H), 2.41 (m, 4H), 1.94 (quint., 2H, J=7.2 Hz), 1.57 (s, 9H); 13C NMR (75 MHz, CDCl3) δ 173.45, 150.31, 149.59, 138.27, 136.36, 128.67, 128.29, 128.27, 107.05, 84.73, 66.23, 33.82, 28.16, 27.62, 23.79; HRMS (ESI) calcd for C19H26N3O4 (MH)+ 360.1917, found 360.1919.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US08927029B2uspto-grants-2015_01