تفاعل #1328412

ord-9378539df71a45bc9c69d7fb62c595b5

معادلة التفاعل

C[C@H](Cc1c[nH]c2c(OCc3ccccc3)cccc12)N1C(=O)c2ccccc2C1=O
(R)-7-Benzyloxy-3-(2-phthalimidopropyl)indole
O
water
O=C[O-].[NH4+]
Ammonium formate
C[C@H](Cc1c[nH]c2c(O)cccc12)N1C(=O)c2ccccc2C1=O
(R)-7-hydroxy-3-(2-phthalimidopropyl)indole

المذيبات

ظروف التفاعل

درجة الحرارة
95°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    أخرىprepared separately
  2. 2
    workup.ADDITIONwas added
  3. 3
    درجة الحرارةAfter cooling down
  4. 4
    ترشيحthe catalyst was filtered off
  5. 5
    تركيزthe filtrate was concentrated under reduced pressure
  6. 6
    workup.ADDITIONAcetone was added to the residue
  7. 7
    ترشيحa deposited salt was filtered off
  8. 8
    تركيزThe filtrate was concentrated under reduced pressure, whereby 10.27 g of a residue
  9. 9
    workup.ADDITIONcontaining the title compound
  10. 10
    أخرىwas obtained

الإجراء التجريبي

(R)-7-Benzyloxy-3-(2-phthalimidopropyl)indole 12.16 g was dissolved in 400 ml of ethanol, and a water 100 ml suspension of a 10% palladium on carbon catalyst (content 50%) 4.00 g prepared separately was added thereto. Ammonium formate 6.00 g was added thereto while stirring, and the suspension was heated in an oil bath of 95° C. For one hour. After cooling down, the catalyst was filtered off, and the filtrate was concentrated under reduced pressure. Acetone was added to the residue, and a deposited salt was filtered off. The filtrate was concentrated under reduced pressure, whereby 10.27 g of a residue containing the title compound was obtained.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US07115412B2uspto-grants-2006_10