تفاعل #1222

ord-66e0b8dbf3514265bd84740660b01c23

معادلة التفاعل

CCOC(=O)c1csc(-c2ccc3cc4c(cc3c2)C(C)(C)CCC4(C)C)c1
ester
CCOC(=O)c1csc(-c2ccc3cc4c(cc3c2)C(C)(C)CCC4(C)C)c1
ethyl 2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-anthryl)-4-thiophenecarboxylate
[Na+].[OH-]
sodium hydroxide
CC1(C)CCC(C)(C)c2cc3cc(-c4cc(C(=O)O)cs4)ccc3cc21
2-(5,6,7,8-tetrahydro-5,5,8,8-tetramethyl-2-anthryl)-4-thiophenecarboxylic acid

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةthe mixture was heated
  2. 2
    درجة الحرارةat reflux for one hour
  3. 3
    أخرىThe reaction medium was evaporated to dryness
  4. 4
    ترشيحthe solids filtered
  5. 5
    أخرىThe product obtained
  6. 6
    أخرىwas recrystallized from an ethyl alcohol/water mixture and 4.5 g (77%) of the expected acid of melting point 223°-225° C.
  7. 7
    أخرىwere recovered

الإجراء التجريبي

6.3 g (16 mmol) of the ester prepared in Example 1 and 100 ml of a 2N methanolic sodium hydroxide solution were introduced into a round-bottomed flask and the mixture was heated at reflux for one hour. The reaction medium was evaporated to dryness, the residue taken up in water, acidified to pH 1 with concentrated hydrochloric acid and the solids filtered. The product obtained was recrystallized from an ethyl alcohol/water mixture and 4.5 g (77%) of the expected acid of melting point 223°-225° C. were recovered.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US05723499uspto-grants-1998_03