تفاعل #1135802

ord-f5bef391de834195a78ed3e7ffb0cc9f

معادلة التفاعل

CI
methyl iodide
Cc1c(Br)cccc1-n1nn[nH]c1=O
1-(2-methyl-3-bromophenyl)-1,4-dihydrotetrazole-5-one
CN(C)C=O
N,N-dimethylformamide
[H-].[Na+]
sodium hydride
Cc1c(Br)cccc1-n1nnn(C)c1=O
1-(2-methyl-3-bromophenyl)-4-methyl-1,4-dihydrotetrazole-5-one

المذيبات

ظروف التفاعل

الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةcooling
  2. 2
    أخرىTo the reaction mixtures
  3. 3
    درجة الحرارةcooling
  4. 4
    درجة الحرارةThe mixtures were raised to room temperature
  5. 5
    workup.STIRRINGwere stirred for fourteen hours
  6. 6
    أخرىTo the reaction mixtures
  7. 7
    استخلاصthe mixtures were extracted with ethyl acetate
  8. 8
    غسيلThe organic layers were washed with 10% hydrochloric acid, water and saturated saline
  9. 9
    تجفيفwere dried over anhydrous magnesium sulfate
  10. 10
    تركيزwere then concentrated under reduced pressure

الإجراء التجريبي

To a mixture of the above-mentioned 1-(2-methyl-3-bromophenyl)-1,4-dihydrotetrazole-5-one 31.40 g and N,N-dimethylformamide 250 mL was added 60% sodium hydride 5.90 g under ice-cooling. The mixtures were raised to room temperature and were stirred for one hour. To the reaction mixtures was added methyl iodide 8.4 mL under ice-cooling. The mixtures were raised to room temperature and were stirred for fourteen hours. To the reaction mixtures was added water and the mixtures were extracted with ethyl acetate. The organic layers were washed with 10% hydrochloric acid, water and saturated saline, and were dried over anhydrous magnesium sulfate and were then concentrated under reduced pressure. The resulting residues were subjected to a silica gel column chromatography to give 1-(2-methyl-3-bromophenyl)-4-methyl-1,4-dihydrotetrazole-5-one (hereinafter, referred to as “Intermediate (PRB-P)”) 8.47 g.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09380782B2uspto-grants-2016_07