تفاعل #1005962

ord-b208a98f8f964c518f29a5c5e2d45938

معادلة التفاعل

CC(C)OB1OC(C)(C)C(C)(C)O1
isopropoxyboronic acid pinacol ester
C1CCOC1
THF
CCSc1ccccc1Br
1-bromo-2-ethylsulfanylbenzene
C1CCOC1
THF
[Li][CH2]CCC
n-butyllithium
CCSc1ccccc1B1OC(C)(C)C(C)(C)O1
2-ethylsulfanylphenylboronic acid pinacol ester
المردود 46.0%

المذيبات

ظروف التفاعل

درجة الحرارة
-70°CELSIUS
الظروف التفصيلية
See reaction.notes.procedure_details.

المعالجة

  1. 1
    درجة الحرارةto maintain an internal temperature of −60° C.
  2. 2
    workup.ADDITIONwas added to the mixture at a rate so as
  3. 3
    درجة الحرارةto maintain an internal temperature of −60° C.
  4. 4
    درجة الحرارةlower, and the mixture was heated to room temperature
  5. 5
    استخلاصthe mixture was extracted with ethyl acetate
  6. 6
    غسيلThe organic layer was washed with water
  7. 7
    تجفيفdried over anhydrous sodium sulfate
  8. 8
    تركيزconcentrated under reduced pressure

الإجراء التجريبي

A mixture of 14.1 g of 1-bromo-2-ethylsulfanylbenzene and 65 mL of THF was cooled to −70° C., and 44.7 mL of n-butyllithium (1.63 M hexane solvent) was added to the mixture at a rate so as to maintain an internal temperature of −60° C. or lower, and the mixture was stirred at −50° C. for 30 minutes. A mixture of 14 g of isopropoxyboronic acid pinacol ester and 5 mL of THF was added to the mixture at a rate so as to maintain an internal temperature of −60° C. or lower, and the mixture was heated to room temperature. Water was poured to the reaction mixture, and the mixture was extracted with ethyl acetate. The organic layer was washed with water, then dried over anhydrous sodium sulfate and concentrated under reduced pressure. The resulting residue was applied to a silica gel column chromatography to obtain 7.9 g of 2-ethylsulfanylphenylboronic acid pinacol ester.

المصدر

DOI: 10.6084/m9.figshare.5104873.v1براءة الاختراع: US09271500B2uspto-grants-2016_03